![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 909.pdf | 2014-11-07 10:14 | 200K | |
| 1469.pdf | 2014-11-07 10:14 | 251K | |
| 1820.pdf | 2014-11-07 10:14 | 186K | |
| Antigen-presenting C..> | 2014-11-07 10:14 | 138K | |
| B cell Biology.pdf | 2014-11-07 10:14 | 2.9M | |
| Cell Microarray.pdf | 2014-11-07 10:14 | 355K | |
| Cell RNAi.pdf | 2014-11-07 10:14 | 1.3M | |
| Chemokines and dendr..> | 2014-11-07 10:14 | 242K | |
| Detection of Melanin..> | 2014-11-07 10:14 | 1.8M | |
| Effects of exogenous..> | 2014-11-07 10:14 | 524K | |
| Gene 1999.pdf | 2014-11-07 10:14 | 171K | |
| Identification of a ..> | 2014-11-07 10:14 | 302K | |
| IgM.doc | 2014-11-07 10:14 | 36K | |
| Immunocytochemical l..> | 2014-11-07 10:14 | 3.8M | |
| Interleukin-7-treate..> | 2014-11-07 10:14 | 262K | |
| LYMPHOSTROMAL INTERA..> | 2014-11-07 10:14 | 2.6M | |
| Molecular Cloning, N..> | 2014-11-07 10:14 | 128K | |
| Patients with active..> | 2014-11-07 10:14 | 197K | |
| Pro- and anti-inflam..> | 2014-11-07 10:14 | 203K | |
| Production of pro- a..> | 2014-11-07 10:14 | 120K | |
| RNAi.pdf | 2014-11-07 10:14 | 45K | |
| The functions of Ca2..> | 2014-11-07 10:14 | 79K | |
| The marsupial Didelp..> | 2014-11-07 10:14 | 39K | |
| The pathobiology of ..> | 2014-11-07 10:14 | 87K | |
| c)HAT_review.pdf | 2014-11-07 10:14 | 394K | |
| cross-presentation.taf | 2014-11-07 10:14 | 2.6M | |
| il12 up e il10 neutr..> | 2014-11-07 10:14 | 145K | |
| interactions of bact..> | 2014-11-07 10:14 | 1.0M | |
| regulation of th cel..> | 2014-11-07 10:14 | 438K | |
| science.pdf | 2014-11-07 10:14 | 4.6M | |
| tolerance.pdf | 2014-11-07 10:14 | 223K | |